C33H22N2O6 — CID 2749322
N,N'-bis(2-methyl-9,10-dioxoanthracen-1-yl)propanediamide (PubChem CID 2749322) has the molecular formula C33H22N2O6 and a molecular weight of 542.55 g/mol. Its IUPAC name is N,N'-bis(2-methyl-9,10-dioxoanthracen-1-yl)propanediamide.
| Compound Name | N,N'-bis(2-methyl-9,10-dioxoanthracen-1-yl)propanediamide |
|---|---|
| PubChem CID | 2749322 |
| Molecular Formula | C33H22N2O6 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | N,N'-bis(2-methyl-9,10-dioxoanthracen-1-yl)propanediamide |
| SMILES | Cc1ccc2c(c1NC(=O)CC(=O)Nc1c(C)ccc3c1C(=O)c1ccccc1C3=O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C33H22N2O6/c1-16-11-13-22-26(32(40)20-9-5-3-7-18(20)30(22)38)28(16)34-24(36)15-25(37)35-29-17(2)12-14-23-27(29)33(41)21-10-6-4-8-19(21)31(23)39/h3-14H,15H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | MMJMLRXZJFGGMT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|