C24H17ClN2O4 — CID 53374197
N-[2-[(2-chloroacetyl)amino]-9,10-dioxoanthracen-1-yl]-2-methylbenzamide (PubChem CID 53374197) has the molecular formula C24H17ClN2O4 and a molecular weight of 432.86 g/mol. Its IUPAC name is N-[2-[(2-chloroacetyl)amino]-9,10-dioxoanthracen-1-yl]-2-methylbenzamide.
| Compound Name | N-[2-[(2-chloroacetyl)amino]-9,10-dioxoanthracen-1-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 53374197 |
| Molecular Formula | C24H17ClN2O4 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[2-[(2-chloroacetyl)amino]-9,10-dioxoanthracen-1-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1c(NC(=O)CCl)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H17ClN2O4/c1-13-6-2-3-7-14(13)24(31)27-21-18(26-19(28)12-25)11-10-17-20(21)23(30)16-9-5-4-8-15(16)22(17)29/h2-11H,12H2,1H3,(H,26,28)(H,27,31) |
| InChIKey | IIRKKRQNCMYTLL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|