C22H14ClNO4 — CID 13110151
2-chloro-N-(9,10-dioxo-4-phenoxyanthracen-1-yl)acetamide (PubChem CID 13110151) has the molecular formula C22H14ClNO4 and a molecular weight of 391.81 g/mol. Its IUPAC name is 2-chloro-N-(9,10-dioxo-4-phenoxyanthracen-1-yl)acetamide.
| Compound Name | 2-chloro-N-(9,10-dioxo-4-phenoxyanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 13110151 |
| Molecular Formula | C22H14ClNO4 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-chloro-N-(9,10-dioxo-4-phenoxyanthracen-1-yl)acetamide |
| SMILES | O=C(CCl)Nc1ccc(Oc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H14ClNO4/c23-12-18(25)24-16-10-11-17(28-13-6-2-1-3-7-13)20-19(16)21(26)14-8-4-5-9-15(14)22(20)27/h1-11H,12H2,(H,24,25) |
| InChIKey | KRTUZNRZIZULIQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|