C18H12Cl2N2O4 — CID 14220963
2-chloro-N-[4-[(2-chloroacetyl)amino]-9,10-dioxoanthracen-1-yl]acetamide (PubChem CID 14220963) has the molecular formula C18H12Cl2N2O4 and a molecular weight of 391.21 g/mol. Its IUPAC name is 2-chloro-N-[4-[(2-chloroacetyl)amino]-9,10-dioxoanthracen-1-yl]acetamide.
| Compound Name | 2-chloro-N-[4-[(2-chloroacetyl)amino]-9,10-dioxoanthracen-1-yl]acetamide |
|---|---|
| PubChem CID | 14220963 |
| Molecular Formula | C18H12Cl2N2O4 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 2-chloro-N-[4-[(2-chloroacetyl)amino]-9,10-dioxoanthracen-1-yl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(NC(=O)CCl)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H12Cl2N2O4/c19-7-13(23)21-11-5-6-12(22-14(24)8-20)16-15(11)17(25)9-3-1-2-4-10(9)18(16)26/h1-6H,7-8H2,(H,21,23)(H,22,24) |
| InChIKey | BGEARAGICAFKJV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|