C48H54N4O6 — CID 70882669
N-[4-[9,10-dioxo-4-[[2-(2,4,4-trimethylpentan-2-ylamino)acetyl]amino]anthracen-1-yl]-9,10-dioxoanthracen-1-yl]-2-(2,4,4-trimethylpentan-2-ylamino)acetamide (PubChem CID 70882669) has the molecular formula C48H54N4O6 and a molecular weight of 782.98 g/mol. Its IUPAC name is N-[4-[9,10-dioxo-4-[[2-(2,4,4-trimethylpentan-2-ylamino)acetyl]amino]anthracen-1-yl]-9,10-dioxoanthracen-1-yl]-2-(2,4,4-trimethylpentan-2-ylamino)acetamide.
| Compound Name | N-[4-[9,10-dioxo-4-[[2-(2,4,4-trimethylpentan-2-ylamino)acetyl]amino]anthracen-1-yl]-9,10-dioxoanthracen-1-yl]-2-(2,4,4-trimethylpentan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 70882669 |
| Molecular Formula | C48H54N4O6 |
| Molecular Weight | 782.98 g/mol |
| Exact Mass | 782.40 |
| IUPAC Name | N-[4-[9,10-dioxo-4-[[2-(2,4,4-trimethylpentan-2-ylamino)acetyl]amino]anthracen-1-yl]-9,10-dioxoanthracen-1-yl]-2-(2,4,4-trimethylpentan-2-ylamino)acetamide |
| SMILES | CC(C)(C)CC(C)(C)NCC(=O)Nc1ccc(-c2ccc(NC(=O)CNC(C)(C)CC(C)(C)C)c3c2C(=O)c2ccccc2C3=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C48H54N4O6/c1-45(2,3)25-47(7,8)49-23-35(53)51-33-21-19-27(37-39(33)43(57)31-17-13-11-15-29(31)41(37)55)28-20-22-34(52-36(54)24-50-48(9,10)26-46(4,5)6)40-38(28)42(56)30-16-12-14-18-32(30)44(40)58/h11-22,49-50H,23-26H2,1-10H3,(H,51,53)(H,52,54) |
| InChIKey | IFFDOORCVUTQGX-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.98 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|