C44H40N2O6 — CID 70882631
2-cyclohexyl-N-[4-[4-[(2-cyclohexylacetyl)amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracen-1-yl]acetamide (PubChem CID 70882631) has the molecular formula C44H40N2O6 and a molecular weight of 692.81 g/mol. Its IUPAC name is 2-cyclohexyl-N-[4-[4-[(2-cyclohexylacetyl)amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracen-1-yl]acetamide.
| Compound Name | 2-cyclohexyl-N-[4-[4-[(2-cyclohexylacetyl)amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracen-1-yl]acetamide |
|---|---|
| PubChem CID | 70882631 |
| Molecular Formula | C44H40N2O6 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | 2-cyclohexyl-N-[4-[4-[(2-cyclohexylacetyl)amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracen-1-yl]acetamide |
| SMILES | O=C(CC1CCCCC1)Nc1ccc(-c2ccc(NC(=O)CC3CCCCC3)c3c2C(=O)c2ccccc2C3=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C44H40N2O6/c47-35(23-25-11-3-1-4-12-25)45-33-21-19-27(37-39(33)43(51)31-17-9-7-15-29(31)41(37)49)28-20-22-34(46-36(48)24-26-13-5-2-6-14-26)40-38(28)42(50)30-16-8-10-18-32(30)44(40)52/h7-10,15-22,25-26H,1-6,11-14,23-24H2,(H,45,47)(H,46,48) |
| InChIKey | LPUCKZNFXDPDOR-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|