C27H17NO4 — CID 56695964
N-(9,10-dioxo-1-phenoxyanthracen-2-yl)benzamide (PubChem CID 56695964) has the molecular formula C27H17NO4 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-(9,10-dioxo-1-phenoxyanthracen-2-yl)benzamide.
| Compound Name | N-(9,10-dioxo-1-phenoxyanthracen-2-yl)benzamide |
|---|---|
| PubChem CID | 56695964 |
| Molecular Formula | C27H17NO4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(9,10-dioxo-1-phenoxyanthracen-2-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1Oc1ccccc1)C(=O)c1ccccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C27H17NO4/c29-24-19-13-7-8-14-20(19)25(30)23-21(24)15-16-22(26(23)32-18-11-5-2-6-12-18)28-27(31)17-9-3-1-4-10-17/h1-16H,(H,28,31) |
| InChIKey | MBLHGIBMNGIIRE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|