C37H26N4O6 — CID 19828301
N-(5-amino-9,10-dioxoanthracen-1-yl)acetamide;N-(5-amino-9,10-dioxoanthracen-1-yl)benzamide (PubChem CID 19828301) has the molecular formula C37H26N4O6 and a molecular weight of 622.64 g/mol. Its IUPAC name is N-(5-amino-9,10-dioxoanthracen-1-yl)acetamide;N-(5-amino-9,10-dioxoanthracen-1-yl)benzamide.
| Compound Name | N-(5-amino-9,10-dioxoanthracen-1-yl)acetamide;N-(5-amino-9,10-dioxoanthracen-1-yl)benzamide |
|---|---|
| PubChem CID | 19828301 |
| Molecular Formula | C37H26N4O6 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | N-(5-amino-9,10-dioxoanthracen-1-yl)acetamide;N-(5-amino-9,10-dioxoanthracen-1-yl)benzamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)c1cccc(N)c1C2=O.Nc1cccc2c1C(=O)c1cccc(NC(=O)c3ccccc3)c1C2=O |
| InChI | InChI=1S/C21H14N2O3.C16H12N2O3/c22-15-10-4-8-13-17(15)19(24)14-9-5-11-16(18(14)20(13)25)23-21(26)12-6-2-1-3-7-12;1-8(19)18-12-7-3-5-10-14(12)16(21)9-4-2-6-11(17)13(9)15(10)20/h1-11H,22H2,(H,23,26);2-7H,17H2,1H3,(H,18,19) |
| InChIKey | BUXRHCLUQCZRQC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|