C21H13ClN2O4 — CID 163695918
N-(5-amino-9,10-dioxoanthracen-1-yl)-4-chloro-2-hydroxybenzamide (PubChem CID 163695918) has the molecular formula C21H13ClN2O4 and a molecular weight of 392.80 g/mol. Its IUPAC name is N-(5-amino-9,10-dioxoanthracen-1-yl)-4-chloro-2-hydroxybenzamide.
| Compound Name | N-(5-amino-9,10-dioxoanthracen-1-yl)-4-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 163695918 |
| Molecular Formula | C21H13ClN2O4 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-(5-amino-9,10-dioxoanthracen-1-yl)-4-chloro-2-hydroxybenzamide |
| SMILES | Nc1cccc2c1C(=O)c1cccc(NC(=O)c3ccc(Cl)cc3O)c1C2=O |
| InChI | InChI=1S/C21H13ClN2O4/c22-10-7-8-11(16(25)9-10)21(28)24-15-6-2-4-13-18(15)20(27)12-3-1-5-14(23)17(12)19(13)26/h1-9,25H,23H2,(H,24,28) |
| InChIKey | JWYARVVICBBTPK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|