C25H16N2O3 — CID 70539193
4-amino-N-(9,10-dioxoanthracen-1-yl)naphthalene-1-carboxamide (PubChem CID 70539193) has the molecular formula C25H16N2O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is 4-amino-N-(9,10-dioxoanthracen-1-yl)naphthalene-1-carboxamide.
| Compound Name | 4-amino-N-(9,10-dioxoanthracen-1-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 70539193 |
| Molecular Formula | C25H16N2O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-amino-N-(9,10-dioxoanthracen-1-yl)naphthalene-1-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)c2ccccc12 |
| InChI | InChI=1S/C25H16N2O3/c26-20-13-12-18(14-6-1-2-7-15(14)20)25(30)27-21-11-5-10-19-22(21)24(29)17-9-4-3-8-16(17)23(19)28/h1-13H,26H2,(H,27,30) |
| InChIKey | DXRURMWFUVQOQP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|