C22H17NO2 — CID 11558929
N-(2,6-dimethylphenyl)-9-oxofluorene-1-carboxamide (PubChem CID 11558929) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-9-oxofluorene-1-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-9-oxofluorene-1-carboxamide |
|---|---|
| PubChem CID | 11558929 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(2,6-dimethylphenyl)-9-oxofluorene-1-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cccc2c1C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C22H17NO2/c1-13-7-5-8-14(2)20(13)23-22(25)18-12-6-11-16-15-9-3-4-10-17(15)21(24)19(16)18/h3-12H,1-2H3,(H,23,25) |
| InChIKey | VHVCTWPJCTWWFY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |