C22H15NO5 — CID 25234415
(2S)-2-hydroxy-2-[3-[(9-oxofluorene-1-carbonyl)amino]phenyl]acetic acid (PubChem CID 25234415) has the molecular formula C22H15NO5 and a molecular weight of 373.36 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-[3-[(9-oxofluorene-1-carbonyl)amino]phenyl]acetic acid.
| Compound Name | (2S)-2-hydroxy-2-[3-[(9-oxofluorene-1-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 25234415 |
| Molecular Formula | C22H15NO5 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (2S)-2-hydroxy-2-[3-[(9-oxofluorene-1-carbonyl)amino]phenyl]acetic acid |
| SMILES | O=C(Nc1cccc([C@H](O)C(=O)O)c1)c1cccc2c1C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C22H15NO5/c24-19(22(27)28)12-5-3-6-13(11-12)23-21(26)17-10-4-9-15-14-7-1-2-8-16(14)20(25)18(15)17/h1-11,19,24H,(H,23,26)(H,27,28)/t19-/m0/s1 |
| InChIKey | GHUAFPQNOPQELI-IBGZPJMESA-N |
| XLogP | 3.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |