C17H12NO4- — CID 7064882
1-(ethylamino)-9,10-dioxoanthracene-2-carboxylate (PubChem CID 7064882) has the molecular formula C17H12NO4- and a molecular weight of 294.29 g/mol. Its IUPAC name is 1-(ethylamino)-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 1-(ethylamino)-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 7064882 |
| Molecular Formula | C17H12NO4- |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-(ethylamino)-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCNc1c(C(=O)[O-])ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H13NO4/c1-2-18-14-12(17(21)22)8-7-11-13(14)16(20)10-6-4-3-5-9(10)15(11)19/h3-8,18H,2H2,1H3,(H,21,22)/p-1 |
| InChIKey | YDFHMUWZGLTUIG-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|