C21H11O5S- — CID 11890222
2-[(S)-(9,10-dioxoanthracen-1-yl)sulfinyl]benzoate (PubChem CID 11890222) has the molecular formula C21H11O5S- and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-[(S)-(9,10-dioxoanthracen-1-yl)sulfinyl]benzoate.
| Compound Name | 2-[(S)-(9,10-dioxoanthracen-1-yl)sulfinyl]benzoate |
|---|---|
| PubChem CID | 11890222 |
| Molecular Formula | C21H11O5S- |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 2-[(S)-(9,10-dioxoanthracen-1-yl)sulfinyl]benzoate |
| SMILES | O=C([O-])c1ccccc1[S@@](=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H12O5S/c22-19-12-6-1-2-7-13(12)20(23)18-15(19)9-5-11-17(18)27(26)16-10-4-3-8-14(16)21(24)25/h1-11H,(H,24,25)/p-1/t27-/m1/s1 |
| InChIKey | HZPXBCLVXRDEFJ-HHHXNRCGSA-M |
| XLogP | 1.99 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|