C39H31O5PS — CID 18948060
benzyl(triphenyl)phosphanium;2-(2-carboxyphenyl)sulfinylbenzoate (PubChem CID 18948060) has the molecular formula C39H31O5PS and a molecular weight of 642.71 g/mol. Its IUPAC name is benzyl(triphenyl)phosphanium;2-(2-carboxyphenyl)sulfinylbenzoate.
| Compound Name | benzyl(triphenyl)phosphanium;2-(2-carboxyphenyl)sulfinylbenzoate |
|---|---|
| PubChem CID | 18948060 |
| Molecular Formula | C39H31O5PS |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | benzyl(triphenyl)phosphanium;2-(2-carboxyphenyl)sulfinylbenzoate |
| SMILES | O=C([O-])c1ccccc1S(=O)c1ccccc1C(=O)O.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P.C14H10O5S/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;15-13(16)9-5-1-3-7-11(9)20(19)12-8-4-2-6-10(12)14(17)18/h1-20H,21H2;1-8H,(H,15,16)(H,17,18)/q+1;/p-1 |
| InChIKey | OHTSUUYYSNTSTL-UHFFFAOYSA-M |
| XLogP | 6.10 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|