C64H52O6P2S — CID 18948081
bis(benzyl(triphenyl)phosphanium);4-(4-carboxylatophenyl)sulfonylbenzoate (PubChem CID 18948081) has the molecular formula C64H52O6P2S and a molecular weight of 1011.13 g/mol. Its IUPAC name is bis(benzyl(triphenyl)phosphanium);4-(4-carboxylatophenyl)sulfonylbenzoate.
| Compound Name | bis(benzyl(triphenyl)phosphanium);4-(4-carboxylatophenyl)sulfonylbenzoate |
|---|---|
| PubChem CID | 18948081 |
| Molecular Formula | C64H52O6P2S |
| Molecular Weight | 1011.13 g/mol |
| Exact Mass | 1010.30 |
| IUPAC Name | bis(benzyl(triphenyl)phosphanium);4-(4-carboxylatophenyl)sulfonylbenzoate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)c2ccc(C(=O)[O-])cc2)cc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C25H22P.C14H10O6S/c2*1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;15-13(16)9-1-5-11(6-2-9)21(19,20)12-7-3-10(4-8-12)14(17)18/h2*1-20H,21H2;1-8H,(H,15,16)(H,17,18)/q2*+1;/p-2 |
| InChIKey | CNVRWJNYOWVRIL-UHFFFAOYSA-L |
| XLogP | 9.61 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.13 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|