C16H6Li2O6 — CID 175522887
dilithium;9,10-dioxoanthracene-1,2-dicarboxylate (PubChem CID 175522887) has the molecular formula C16H6Li2O6 and a molecular weight of 308.10 g/mol. Its IUPAC name is dilithium;9,10-dioxoanthracene-1,2-dicarboxylate.
| Compound Name | dilithium;9,10-dioxoanthracene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 175522887 |
| Molecular Formula | C16H6Li2O6 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | dilithium;9,10-dioxoanthracene-1,2-dicarboxylate |
| SMILES | O=C([O-])c1ccc2c(c1C(=O)[O-])C(=O)c1ccccc1C2=O.[Li+].[Li+] |
| InChI | InChI=1S/C16H8O6.2Li/c17-13-7-3-1-2-4-8(7)14(18)11-9(13)5-6-10(15(19)20)12(11)16(21)22;;/h1-6H,(H,19,20)(H,21,22);;/q;2*+1/p-2 |
| InChIKey | KBGJQIIWWHKUPO-UHFFFAOYSA-L |
| XLogP | -6.80 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | -6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|