C22H14O5 — CID 150017860
9,10-dioxo-2-phenylmethoxyanthracene-1-carboxylic acid (PubChem CID 150017860) has the molecular formula C22H14O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 9,10-dioxo-2-phenylmethoxyanthracene-1-carboxylic acid.
| Compound Name | 9,10-dioxo-2-phenylmethoxyanthracene-1-carboxylic acid |
|---|---|
| PubChem CID | 150017860 |
| Molecular Formula | C22H14O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 9,10-dioxo-2-phenylmethoxyanthracene-1-carboxylic acid |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(OCc1ccccc1)c2C(=O)O |
| InChI | InChI=1S/C22H14O5/c23-20-14-8-4-5-9-15(14)21(24)18-16(20)10-11-17(19(18)22(25)26)27-12-13-6-2-1-3-7-13/h1-11H,12H2,(H,25,26) |
| InChIKey | DEQGDBRFJQUNDZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|