C16H10O6 — CID 20527657
2-(1-hydroxy-9,10-dioxoanthracen-2-yl)oxyacetic acid (PubChem CID 20527657) has the molecular formula C16H10O6 and a molecular weight of 298.25 g/mol. Its IUPAC name is 2-(1-hydroxy-9,10-dioxoanthracen-2-yl)oxyacetic acid.
| Compound Name | 2-(1-hydroxy-9,10-dioxoanthracen-2-yl)oxyacetic acid |
|---|---|
| PubChem CID | 20527657 |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-(1-hydroxy-9,10-dioxoanthracen-2-yl)oxyacetic acid |
| SMILES | O=C(O)COc1ccc2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H10O6/c17-12(18)7-22-11-6-5-10-13(16(11)21)15(20)9-4-2-1-3-8(9)14(10)19/h1-6,21H,7H2,(H,17,18) |
| InChIKey | OXFSUVSJHAHJTN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|