C22H14ClNO8S — CID 164971915
2-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-9,10-dioxoanthracen-2-yl]oxyacetic acid (PubChem CID 164971915) has the molecular formula C22H14ClNO8S and a molecular weight of 487.87 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-9,10-dioxoanthracen-2-yl]oxyacetic acid.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-9,10-dioxoanthracen-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 164971915 |
| Molecular Formula | C22H14ClNO8S |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-9,10-dioxoanthracen-2-yl]oxyacetic acid |
| SMILES | O=C(O)COc1cc(NS(=O)(=O)c2ccc(Cl)cc2)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H14ClNO8S/c23-11-5-7-12(8-6-11)33(30,31)24-15-9-16(32-10-17(25)26)22(29)19-18(15)20(27)13-3-1-2-4-14(13)21(19)28/h1-9,24,29H,10H2,(H,25,26) |
| InChIKey | DFWSURPCBLDIQV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|