C26H16ClNO6S — CID 162661456
4-(4-chlorophenyl)-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide (PubChem CID 162661456) has the molecular formula C26H16ClNO6S and a molecular weight of 505.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide.
| Compound Name | 4-(4-chlorophenyl)-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 162661456 |
| Molecular Formula | C26H16ClNO6S |
| Molecular Weight | 505.94 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(NS(=O)(=O)c1ccc(-c3ccc(Cl)cc3)cc1)c(O)c2O |
| InChI | InChI=1S/C26H16ClNO6S/c27-16-9-5-14(6-10-16)15-7-11-17(12-8-15)35(33,34)28-21-13-20-22(26(32)25(21)31)24(30)19-4-2-1-3-18(19)23(20)29/h1-13,28,31-32H |
| InChIKey | SOUISYZFHQMZEL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.94 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|