C25H18Cl2N2O3S2 — CID 22495835
5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(2-phenyl-3-sulfanylphenyl)benzamide (PubChem CID 22495835) has the molecular formula C25H18Cl2N2O3S2 and a molecular weight of 529.47 g/mol. Its IUPAC name is 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(2-phenyl-3-sulfanylphenyl)benzamide.
| Compound Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(2-phenyl-3-sulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 22495835 |
| Molecular Formula | C25H18Cl2N2O3S2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.01 |
| IUPAC Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(2-phenyl-3-sulfanylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(S)c1-c1ccccc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18Cl2N2O3S2/c26-17-9-12-19(13-10-17)34(31,32)29-21-14-11-18(27)15-20(21)25(30)28-22-7-4-8-23(33)24(22)16-5-2-1-3-6-16/h1-15,29,33H,(H,28,30) |
| InChIKey | LAFAMYPLZQJQGC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|