C21H14ClNO8S2 — CID 165052254
[3-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-9,10-dioxoanthracen-2-yl] methanesulfonate (PubChem CID 165052254) has the molecular formula C21H14ClNO8S2 and a molecular weight of 507.93 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-9,10-dioxoanthracen-2-yl] methanesulfonate.
| Compound Name | [3-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-9,10-dioxoanthracen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 165052254 |
| Molecular Formula | C21H14ClNO8S2 |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | [3-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-9,10-dioxoanthracen-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1c(NS(=O)(=O)c2ccc(Cl)cc2)cc2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H14ClNO8S2/c1-32(27,28)31-21-16(23-33(29,30)12-8-6-11(22)7-9-12)10-15-17(20(21)26)19(25)14-5-3-2-4-13(14)18(15)24/h2-10,23,26H,1H3 |
| InChIKey | PVTDUVNBANXPNP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|