C27H22Cl2N2O6S2 — CID 6215666
4-chloro-N-[4-[(4-chlorophenyl)sulfonylamino]-3-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]naphthalen-1-yl]benzenesulfonamide (PubChem CID 6215666) has the molecular formula C27H22Cl2N2O6S2 and a molecular weight of 605.52 g/mol. Its IUPAC name is 4-chloro-N-[4-[(4-chlorophenyl)sulfonylamino]-3-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]naphthalen-1-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-[(4-chlorophenyl)sulfonylamino]-3-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]naphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 6215666 |
| Molecular Formula | C27H22Cl2N2O6S2 |
| Molecular Weight | 605.52 g/mol |
| Exact Mass | 604.03 |
| IUPAC Name | 4-chloro-N-[4-[(4-chlorophenyl)sulfonylamino]-3-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]naphthalen-1-yl]benzenesulfonamide |
| SMILES | CC(=O)/C(=C(/C)O)c1cc(NS(=O)(=O)c2ccc(Cl)cc2)c2ccccc2c1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22Cl2N2O6S2/c1-16(32)26(17(2)33)24-15-25(30-38(34,35)20-11-7-18(28)8-12-20)22-5-3-4-6-23(22)27(24)31-39(36,37)21-13-9-19(29)10-14-21/h3-15,30-32H,1-2H3/b26-16+ |
| InChIKey | UIZIDSHRXLQISO-WGOQTCKBSA-N |
| XLogP | 6.63 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|