C23H16ClN3O6S — CID 3478501
N-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]imino-2,4-dihydroxybenzamide (PubChem CID 3478501) has the molecular formula C23H16ClN3O6S and a molecular weight of 497.92 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]imino-2,4-dihydroxybenzamide.
| Compound Name | N-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]imino-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 3478501 |
| Molecular Formula | C23H16ClN3O6S |
| Molecular Weight | 497.92 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | N-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]imino-2,4-dihydroxybenzamide |
| SMILES | O=C(/N=N/c1cc(NS(=O)(=O)c2ccc(Cl)cc2)c2ccccc2c1O)c1ccc(O)cc1O |
| InChI | InChI=1S/C23H16ClN3O6S/c24-13-5-8-15(9-6-13)34(32,33)27-19-12-20(22(30)17-4-2-1-3-16(17)19)25-26-23(31)18-10-7-14(28)11-21(18)29/h1-12,27-30H/b26-25+ |
| InChIKey | AYNBFYHEAVTKMN-OCEACIFDSA-N |
| XLogP | 5.33 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.92 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|