C23H16ClN3O4S — CID 5089017
N-[4-(benzenesulfonamido)-1-hydroxynaphthalen-2-yl]imino-3-chlorobenzamide (PubChem CID 5089017) has the molecular formula C23H16ClN3O4S and a molecular weight of 465.92 g/mol. Its IUPAC name is N-[4-(benzenesulfonamido)-1-hydroxynaphthalen-2-yl]imino-3-chlorobenzamide.
| Compound Name | N-[4-(benzenesulfonamido)-1-hydroxynaphthalen-2-yl]imino-3-chlorobenzamide |
|---|---|
| PubChem CID | 5089017 |
| Molecular Formula | C23H16ClN3O4S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | N-[4-(benzenesulfonamido)-1-hydroxynaphthalen-2-yl]imino-3-chlorobenzamide |
| SMILES | O=C(/N=N/c1cc(NS(=O)(=O)c2ccccc2)c2ccccc2c1O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H16ClN3O4S/c24-16-8-6-7-15(13-16)23(29)26-25-21-14-20(18-11-4-5-12-19(18)22(21)28)27-32(30,31)17-9-2-1-3-10-17/h1-14,27-28H/b26-25+ |
| InChIKey | BXBYCZSKIQBFLZ-OCEACIFDSA-N |
| XLogP | 5.92 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|