C30H24ClN3O5S — CID 135669390
N-[[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-5,8-dihydronaphthalen-2-yl]imino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 135669390) has the molecular formula C30H24ClN3O5S and a molecular weight of 574.06 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-5,8-dihydronaphthalen-2-yl]imino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-5,8-dihydronaphthalen-2-yl]imino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 135669390 |
| Molecular Formula | C30H24ClN3O5S |
| Molecular Weight | 574.06 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxy-5,8-dihydronaphthalen-2-yl]imino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | O=C(/N=N/c1cc(NS(=O)(=O)c2ccc(Cl)cc2)c2c(c1O)CC=CC2)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24ClN3O5S/c31-22-15-17-23(18-16-22)40(38,39)34-26-19-27(28(35)25-14-8-7-13-24(25)26)32-33-29(36)30(37,20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-12,15-19,34-35,37H,13-14H2/b33-32+ |
| InChIKey | MDQFQGVCEYJERQ-ULIFNZDWSA-N |
| XLogP | 6.05 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.06 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|