C23H14ClN5O8S — CID 3473999
N-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]imino-2,4-dinitrobenzamide (PubChem CID 3473999) has the molecular formula C23H14ClN5O8S and a molecular weight of 555.91 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]imino-2,4-dinitrobenzamide.
| Compound Name | N-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]imino-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3473999 |
| Molecular Formula | C23H14ClN5O8S |
| Molecular Weight | 555.91 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | N-[4-[(4-chlorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]imino-2,4-dinitrobenzamide |
| SMILES | O=C(/N=N/c1cc(NS(=O)(=O)c2ccc(Cl)cc2)c2ccccc2c1O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H14ClN5O8S/c24-13-5-8-15(9-6-13)38(36,37)27-19-12-20(22(30)17-4-2-1-3-16(17)19)25-26-23(31)18-10-7-14(28(32)33)11-21(18)29(34)35/h1-12,27,30H/b26-25+ |
| InChIKey | UUEJGAHVDHMNKS-OCEACIFDSA-N |
| XLogP | 5.74 |
| TPSA | 194.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.91 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|