C24H20N4O4S — CID 3463382
3-amino-N-[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]iminobenzamide (PubChem CID 3463382) has the molecular formula C24H20N4O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is 3-amino-N-[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]iminobenzamide.
| Compound Name | 3-amino-N-[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]iminobenzamide |
|---|---|
| PubChem CID | 3463382 |
| Molecular Formula | C24H20N4O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-amino-N-[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]naphthalen-2-yl]iminobenzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(/N=N/C(=O)c3cccc(N)c3)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H20N4O4S/c1-15-9-11-18(12-10-15)33(31,32)28-21-14-22(23(29)20-8-3-2-7-19(20)21)26-27-24(30)16-5-4-6-17(25)13-16/h2-14,28-29H,25H2,1H3/b27-26+ |
| InChIKey | DQVWLWGXYIBJGL-CYYJNZCTSA-N |
| XLogP | 5.16 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|