C24H21N3O6S — CID 135669410
3,5-dihydroxy-N-[[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-2-yl]imino]benzamide (PubChem CID 135669410) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-2-yl]imino]benzamide.
| Compound Name | 3,5-dihydroxy-N-[[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-2-yl]imino]benzamide |
|---|---|
| PubChem CID | 135669410 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 3,5-dihydroxy-N-[[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-2-yl]imino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(/N=N/C(=O)c3cc(O)cc(O)c3)c(O)c3c2CC=CC3)cc1 |
| InChI | InChI=1S/C24H21N3O6S/c1-14-6-8-18(9-7-14)34(32,33)27-21-13-22(23(30)20-5-3-2-4-19(20)21)25-26-24(31)15-10-16(28)12-17(29)11-15/h2-3,6-13,27-30H,4-5H2,1H3/b26-25+ |
| InChIKey | BNJOOWZMGRNZGQ-OCEACIFDSA-N |
| XLogP | 4.49 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|