C23H22N4O4S — CID 135669407
N-[[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-2-yl]imino]-1,2-dihydropyridine-4-carboxamide (PubChem CID 135669407) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-[[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-2-yl]imino]-1,2-dihydropyridine-4-carboxamide.
| Compound Name | N-[[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-2-yl]imino]-1,2-dihydropyridine-4-carboxamide |
|---|---|
| PubChem CID | 135669407 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[[1-hydroxy-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-2-yl]imino]-1,2-dihydropyridine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(/N=N/C(=O)C3=CCNC=C3)c(O)c3c2CC=CC3)cc1 |
| InChI | InChI=1S/C23H22N4O4S/c1-15-6-8-17(9-7-15)32(30,31)27-20-14-21(22(28)19-5-3-2-4-18(19)20)25-26-23(29)16-10-12-24-13-11-16/h2-3,6-12,14,24,27-28H,4-5,13H2,1H3/b26-25+ |
| InChIKey | QSGOTRFMKDTVNU-OCEACIFDSA-N |
| XLogP | 3.81 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|