C25H21N3O6S — CID 3487122
N-[1-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]naphthalen-2-yl]imino-4-methoxybenzamide (PubChem CID 3487122) has the molecular formula C25H21N3O6S and a molecular weight of 491.53 g/mol. Its IUPAC name is N-[1-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]naphthalen-2-yl]imino-4-methoxybenzamide.
| Compound Name | N-[1-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]naphthalen-2-yl]imino-4-methoxybenzamide |
|---|---|
| PubChem CID | 3487122 |
| Molecular Formula | C25H21N3O6S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | N-[1-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]naphthalen-2-yl]imino-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)/N=N/c2cc(NS(=O)(=O)c3ccc(OC)cc3)c3ccccc3c2O)cc1 |
| InChI | InChI=1S/C25H21N3O6S/c1-33-17-9-7-16(8-10-17)25(30)27-26-23-15-22(20-5-3-4-6-21(20)24(23)29)28-35(31,32)19-13-11-18(34-2)12-14-19/h3-15,28-29H,1-2H3/b27-26+ |
| InChIKey | MSUDKFDNRPNBFS-CYYJNZCTSA-N |
| XLogP | 5.29 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|