C23H17N3O6S — CID 135777327
N-[4-(benzenesulfonamido)-1-hydroxynaphthalen-2-yl]imino-3,5-dihydroxybenzamide (PubChem CID 135777327) has the molecular formula C23H17N3O6S and a molecular weight of 463.47 g/mol. Its IUPAC name is N-[4-(benzenesulfonamido)-1-hydroxynaphthalen-2-yl]imino-3,5-dihydroxybenzamide.
| Compound Name | N-[4-(benzenesulfonamido)-1-hydroxynaphthalen-2-yl]imino-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 135777327 |
| Molecular Formula | C23H17N3O6S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | N-[4-(benzenesulfonamido)-1-hydroxynaphthalen-2-yl]imino-3,5-dihydroxybenzamide |
| SMILES | O=C(/N=N/c1cc(NS(=O)(=O)c2ccccc2)c2ccccc2c1O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C23H17N3O6S/c27-15-10-14(11-16(28)12-15)23(30)25-24-21-13-20(18-8-4-5-9-19(18)22(21)29)26-33(31,32)17-6-2-1-3-7-17/h1-13,26-29H/b25-24+ |
| InChIKey | VEZBNKFIOIAQKZ-OCOZRVBESA-N |
| XLogP | 4.68 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|