C18H17N3O4S — CID 135669412
N-[[1-hydroxy-4-(methanesulfonamido)-5,8-dihydronaphthalen-2-yl]imino]benzamide (PubChem CID 135669412) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-[[1-hydroxy-4-(methanesulfonamido)-5,8-dihydronaphthalen-2-yl]imino]benzamide.
| Compound Name | N-[[1-hydroxy-4-(methanesulfonamido)-5,8-dihydronaphthalen-2-yl]imino]benzamide |
|---|---|
| PubChem CID | 135669412 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[[1-hydroxy-4-(methanesulfonamido)-5,8-dihydronaphthalen-2-yl]imino]benzamide |
| SMILES | CS(=O)(=O)Nc1cc(/N=N/C(=O)c2ccccc2)c(O)c2c1CC=CC2 |
| InChI | InChI=1S/C18H17N3O4S/c1-26(24,25)21-15-11-16(17(22)14-10-6-5-9-13(14)15)19-20-18(23)12-7-3-2-4-8-12/h2-8,11,21-22H,9-10H2,1H3/b20-19+ |
| InChIKey | HYCFCKLXXVRTAJ-FMQUCBEESA-N |
| XLogP | 3.34 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|