About N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide
N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide (PubChem CID 167050073) has the molecular formula C8H8INO2S
and a molecular weight of 309.13 g/mol. Its IUPAC name is N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide.
Molecular Properties
| Compound Name | N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide |
| PubChem CID | 167050073 |
| Molecular Formula | C8H8INO2S |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide |
| SMILES | CS(=O)(I)=NC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8INO2S/c1-13(9,12)10-8(11)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | RZLYHLFZTSYTBV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide?
The IUPAC name of N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide (CID 167050073) is N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide.
What is the SMILES notation for N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide?
The canonical SMILES for N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide is CS(=O)(I)=NC(=O)c1ccccc1.
What is the InChIKey of N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide?
The InChIKey is RZLYHLFZTSYTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO2S/c1-13(9,12)10-8(11)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide?
N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide has a molecular weight of 309.13 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(iodo-methyl-oxo-λ6-sulfanylidene)benzamide is sourced from PubChem (CID 167050073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).