About benzoyl isothiocyanate;ethane
benzoyl isothiocyanate;ethane (PubChem CID 90887579) has the molecular formula C10H11NOS
and a molecular weight of 193.27 g/mol. Its IUPAC name is benzoyl isothiocyanate;ethane.
Molecular Properties
| Compound Name | benzoyl isothiocyanate;ethane |
| PubChem CID | 90887579 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | benzoyl isothiocyanate;ethane |
| SMILES | CC.O=C(N=C=S)c1ccccc1 |
| InChI | InChI=1S/C8H5NOS.C2H6/c10-8(9-6-11)7-4-2-1-3-5-7;1-2/h1-5H;1-2H3 |
| InChIKey | CUFWRFNUVKLXQF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzoyl isothiocyanate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl isothiocyanate;ethane?
The IUPAC name of benzoyl isothiocyanate;ethane (CID 90887579) is benzoyl isothiocyanate;ethane.
What is the SMILES notation for benzoyl isothiocyanate;ethane?
The canonical SMILES for benzoyl isothiocyanate;ethane is CC.O=C(N=C=S)c1ccccc1.
What is the InChIKey of benzoyl isothiocyanate;ethane?
The InChIKey is CUFWRFNUVKLXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NOS.C2H6/c10-8(9-6-11)7-4-2-1-3-5-7;1-2/h1-5H;1-2H3.
What are the key properties of benzoyl isothiocyanate;ethane?
benzoyl isothiocyanate;ethane has a molecular weight of 193.27 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl isothiocyanate;ethane is sourced from PubChem (CID 90887579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).