About ethane;propane;N-propan-2-ylidenebenzamide
ethane;propane;N-propan-2-ylidenebenzamide (PubChem CID 91020892) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;propane;N-propan-2-ylidenebenzamide.
Molecular Properties
| Compound Name | ethane;propane;N-propan-2-ylidenebenzamide |
| PubChem CID | 91020892 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | ethane;propane;N-propan-2-ylidenebenzamide |
| SMILES | CC.CC(C)=NC(=O)c1ccccc1.CCC |
| InChI | InChI=1S/C10H11NO.C3H8.C2H6/c1-8(2)11-10(12)9-6-4-3-5-7-9;1-3-2;1-2/h3-7H,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | JOTMATQQJAFAHY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;propane;N-propan-2-ylidenebenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;N-propan-2-ylidenebenzamide?
The IUPAC name of ethane;propane;N-propan-2-ylidenebenzamide (CID 91020892) is ethane;propane;N-propan-2-ylidenebenzamide.
What is the SMILES notation for ethane;propane;N-propan-2-ylidenebenzamide?
The canonical SMILES for ethane;propane;N-propan-2-ylidenebenzamide is CC.CC(C)=NC(=O)c1ccccc1.CCC.
What is the InChIKey of ethane;propane;N-propan-2-ylidenebenzamide?
The InChIKey is JOTMATQQJAFAHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C3H8.C2H6/c1-8(2)11-10(12)9-6-4-3-5-7-9;1-3-2;1-2/h3-7H,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;N-propan-2-ylidenebenzamide?
ethane;propane;N-propan-2-ylidenebenzamide has a molecular weight of 235.37 g/mol, XLogP of 4.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;N-propan-2-ylidenebenzamide is sourced from PubChem (CID 91020892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).