About benzoyl isothiocyanate;dichloromethane
benzoyl isothiocyanate;dichloromethane (PubChem CID 159613659) has the molecular formula C9H7Cl2NOS
and a molecular weight of 248.13 g/mol. Its IUPAC name is benzoyl isothiocyanate;dichloromethane.
Molecular Properties
| Compound Name | benzoyl isothiocyanate;dichloromethane |
| PubChem CID | 159613659 |
| Molecular Formula | C9H7Cl2NOS |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | benzoyl isothiocyanate;dichloromethane |
| SMILES | ClCCl.O=C(N=C=S)c1ccccc1 |
| InChI | InChI=1S/C8H5NOS.CH2Cl2/c10-8(9-6-11)7-4-2-1-3-5-7;2-1-3/h1-5H;1H2 |
| InChIKey | MNACYRIEOIRBAT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzoyl isothiocyanate;dichloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl isothiocyanate;dichloromethane?
The IUPAC name of benzoyl isothiocyanate;dichloromethane (CID 159613659) is benzoyl isothiocyanate;dichloromethane.
What is the SMILES notation for benzoyl isothiocyanate;dichloromethane?
The canonical SMILES for benzoyl isothiocyanate;dichloromethane is ClCCl.O=C(N=C=S)c1ccccc1.
What is the InChIKey of benzoyl isothiocyanate;dichloromethane?
The InChIKey is MNACYRIEOIRBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NOS.CH2Cl2/c10-8(9-6-11)7-4-2-1-3-5-7;2-1-3/h1-5H;1H2.
What are the key properties of benzoyl isothiocyanate;dichloromethane?
benzoyl isothiocyanate;dichloromethane has a molecular weight of 248.13 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl isothiocyanate;dichloromethane is sourced from PubChem (CID 159613659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).