About naphthalene-2-carbonyl isothiocyanate
naphthalene-2-carbonyl isothiocyanate (PubChem CID 2113413) has the molecular formula C12H7NOS
and a molecular weight of 213.26 g/mol. Its IUPAC name is naphthalene-2-carbonyl isothiocyanate.
Molecular Properties
| Compound Name | naphthalene-2-carbonyl isothiocyanate |
| PubChem CID | 2113413 |
| Molecular Formula | C12H7NOS |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | naphthalene-2-carbonyl isothiocyanate |
| SMILES | O=C(N=C=S)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H7NOS/c14-12(13-8-15)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H |
| InChIKey | IGDMFCQPAMIOMX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-2-carbonyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2-carbonyl isothiocyanate?
The IUPAC name of naphthalene-2-carbonyl isothiocyanate (CID 2113413) is naphthalene-2-carbonyl isothiocyanate.
What is the SMILES notation for naphthalene-2-carbonyl isothiocyanate?
The canonical SMILES for naphthalene-2-carbonyl isothiocyanate is O=C(N=C=S)c1ccc2ccccc2c1.
What is the InChIKey of naphthalene-2-carbonyl isothiocyanate?
The InChIKey is IGDMFCQPAMIOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NOS/c14-12(13-8-15)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H.
What are the key properties of naphthalene-2-carbonyl isothiocyanate?
naphthalene-2-carbonyl isothiocyanate has a molecular weight of 213.26 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2-carbonyl isothiocyanate is sourced from PubChem (CID 2113413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).