C10H3F6NOS — CID 16776495
3,5-bis(trifluoromethyl)benzoyl isothiocyanate (PubChem CID 16776495) has the molecular formula C10H3F6NOS and a molecular weight of 299.20 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)benzoyl isothiocyanate.
| Compound Name | 3,5-bis(trifluoromethyl)benzoyl isothiocyanate |
|---|---|
| PubChem CID | 16776495 |
| Molecular Formula | C10H3F6NOS |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 3,5-bis(trifluoromethyl)benzoyl isothiocyanate |
| SMILES | O=C(N=C=S)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H3F6NOS/c11-9(12,13)6-1-5(8(18)17-4-19)2-7(3-6)10(14,15)16/h1-3H |
| InChIKey | JNHJDEQXMYDRGU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|