C11H7ClF6N2O — CID 14346364
N-(1-amino-2-chloroethylidene)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 14346364) has the molecular formula C11H7ClF6N2O and a molecular weight of 332.63 g/mol. Its IUPAC name is N-(1-amino-2-chloroethylidene)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(1-amino-2-chloroethylidene)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 14346364 |
| Molecular Formula | C11H7ClF6N2O |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-(1-amino-2-chloroethylidene)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | N/C(CCl)=N/C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7ClF6N2O/c12-4-8(19)20-9(21)5-1-6(10(13,14)15)3-7(2-5)11(16,17)18/h1-3H,4H2,(H2,19,20,21) |
| InChIKey | LTJAOLQLPNDPFH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|