C9H7ClF6N2 — CID 2736101
[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]azanium chloride (PubChem CID 2736101) has the molecular formula C9H7ClF6N2 and a molecular weight of 292.61 g/mol. Its IUPAC name is [amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]azanium chloride.
| Compound Name | [amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]azanium chloride |
|---|---|
| PubChem CID | 2736101 |
| Molecular Formula | C9H7ClF6N2 |
| Molecular Weight | 292.61 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | [amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]azanium chloride |
| SMILES | NC(=[NH2+])c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Cl-] |
| InChI | InChI=1S/C9H6F6N2.ClH/c10-8(11,12)5-1-4(7(16)17)2-6(3-5)9(13,14)15;/h1-3H,(H3,16,17);1H |
| InChIKey | GOCQSQHVIVLYOG-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.61 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|