C12H9F6NO3 — CID 7796154
[(2S)-1-amino-1-oxopropan-2-yl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 7796154) has the molecular formula C12H9F6NO3 and a molecular weight of 329.20 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7796154 |
| Molecular Formula | C12H9F6NO3 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | C[C@H](OC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(N)=O |
| InChI | InChI=1S/C12H9F6NO3/c1-5(9(19)20)22-10(21)6-2-7(11(13,14)15)4-8(3-6)12(16,17)18/h2-5H,1H3,(H2,19,20)/t5-/m0/s1 |
| InChIKey | FEHZAWLRUKWVFH-YFKPBYRVSA-N |
| XLogP | 2.75 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |