C17H14F3NO3 — CID 2103644
[(2S)-1-amino-1-oxopropan-2-yl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 2103644) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 2103644 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1)C(N)=O |
| InChI | InChI=1S/C17H14F3NO3/c1-10(15(21)22)24-16(23)14-5-3-2-4-13(14)11-6-8-12(9-7-11)17(18,19)20/h2-10H,1H3,(H2,21,22)/t10-/m0/s1 |
| InChIKey | IMVJWYAESYXXFG-JTQLQIEISA-N |
| XLogP | 3.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |