C20H10F12O4 — CID 154171146
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]benzoate (PubChem CID 154171146) has the molecular formula C20H10F12O4 and a molecular weight of 542.27 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]benzoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]benzoate |
|---|---|
| PubChem CID | 154171146 |
| Molecular Formula | C20H10F12O4 |
| Molecular Weight | 542.27 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]benzoate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)c1ccccc1-c1ccccc1C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H10F12O4/c21-17(22,23)15(18(24,25)26)35-13(33)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(34)36-16(19(27,28)29)20(30,31)32/h1-8,15-16H |
| InChIKey | IPADWZLJBDZMHD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.27 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |