C22H15F6O2S+ — CID 164746718
[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]-diphenylsulfanium (PubChem CID 164746718) has the molecular formula C22H15F6O2S+ and a molecular weight of 457.42 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]-diphenylsulfanium.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 164746718 |
| Molecular Formula | C22H15F6O2S+ |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)phenyl]-diphenylsulfanium |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)c1cccc([S+](c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H15F6O2S/c23-21(24,25)20(22(26,27)28)30-19(29)15-8-7-13-18(14-15)31(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,20H/q+1 |
| InChIKey | RSWHITLUPAGVPD-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|