C26H21F6O4S+ — CID 177131968
[3,4-bis(1,1,1-trifluoropropan-2-yloxycarbonyl)phenyl]-diphenylsulfanium (PubChem CID 177131968) has the molecular formula C26H21F6O4S+ and a molecular weight of 543.51 g/mol. Its IUPAC name is [3,4-bis(1,1,1-trifluoropropan-2-yloxycarbonyl)phenyl]-diphenylsulfanium.
| Compound Name | [3,4-bis(1,1,1-trifluoropropan-2-yloxycarbonyl)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 177131968 |
| Molecular Formula | C26H21F6O4S+ |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | [3,4-bis(1,1,1-trifluoropropan-2-yloxycarbonyl)phenyl]-diphenylsulfanium |
| SMILES | CC(OC(=O)c1ccc([S+](c2ccccc2)c2ccccc2)cc1C(=O)OC(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H21F6O4S/c1-16(25(27,28)29)35-23(33)21-14-13-20(15-22(21)24(34)36-17(2)26(30,31)32)37(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-17H,1-2H3/q+1 |
| InChIKey | AFIANJQAUSSGDF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|