C22H16F3O2S+ — CID 171721859
1,1,1-trifluoropropan-2-yl 4-dibenzothiophen-5-ium-5-ylbenzoate (PubChem CID 171721859) has the molecular formula C22H16F3O2S+ and a molecular weight of 401.43 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 4-dibenzothiophen-5-ium-5-ylbenzoate.
| Compound Name | 1,1,1-trifluoropropan-2-yl 4-dibenzothiophen-5-ium-5-ylbenzoate |
|---|---|
| PubChem CID | 171721859 |
| Molecular Formula | C22H16F3O2S+ |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 4-dibenzothiophen-5-ium-5-ylbenzoate |
| SMILES | CC(OC(=O)c1ccc(-[s+]2c3ccccc3c3ccccc32)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H16F3O2S/c1-14(22(23,24)25)27-21(26)15-10-12-16(13-11-15)28-19-8-4-2-6-17(19)18-7-3-5-9-20(18)28/h2-14H,1H3/q+1 |
| InChIKey | BCQNNCVCGJSHIY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|