About (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate
(1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate (PubChem CID 169051216) has the molecular formula C25H19O2S+
and a molecular weight of 383.49 g/mol. Its IUPAC name is (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate.
Molecular Properties
| Compound Name | (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate |
| PubChem CID | 169051216 |
| Molecular Formula | C25H19O2S+ |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate |
| SMILES | C#CC1(OC(=O)c2ccc(-[s+]3c4ccccc4c4ccccc43)cc2)CCC1 |
| InChI | InChI=1S/C25H19O2S/c1-2-25(16-7-17-25)27-24(26)18-12-14-19(15-13-18)28-22-10-5-3-8-20(22)21-9-4-6-11-23(21)28/h1,3-6,8-15H,7,16-17H2/q+1 |
| InChIKey | LPNHHDNROPHMRY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate?
The IUPAC name of (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate (CID 169051216) is (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate.
What is the SMILES notation for (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate?
The canonical SMILES for (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate is C#CC1(OC(=O)c2ccc(-[s+]3c4ccccc4c4ccccc43)cc2)CCC1.
What is the InChIKey of (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate?
The InChIKey is LPNHHDNROPHMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19O2S/c1-2-25(16-7-17-25)27-24(26)18-12-14-19(15-13-18)28-22-10-5-3-8-20(22)21-9-4-6-11-23(21)28/h1,3-6,8-15H,7,16-17H2/q+1.
What are the key properties of (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate?
(1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate has a molecular weight of 383.49 g/mol, XLogP of 6.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethynylcyclobutyl) 4-dibenzothiophen-5-ium-5-ylbenzoate is sourced from PubChem (CID 169051216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).