C29H25O2S+ — CID 169051491
[1-(2-cyclobutylethynyl)cyclobutyl] 4-dibenzothiophen-5-ium-5-ylbenzoate (PubChem CID 169051491) has the molecular formula C29H25O2S+ and a molecular weight of 437.58 g/mol. Its IUPAC name is [1-(2-cyclobutylethynyl)cyclobutyl] 4-dibenzothiophen-5-ium-5-ylbenzoate.
| Compound Name | [1-(2-cyclobutylethynyl)cyclobutyl] 4-dibenzothiophen-5-ium-5-ylbenzoate |
|---|---|
| PubChem CID | 169051491 |
| Molecular Formula | C29H25O2S+ |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [1-(2-cyclobutylethynyl)cyclobutyl] 4-dibenzothiophen-5-ium-5-ylbenzoate |
| SMILES | O=C(OC1(C#CC2CCC2)CCC1)c1ccc(-[s+]2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C29H25O2S/c30-28(31-29(18-6-19-29)20-17-21-7-5-8-21)22-13-15-23(16-14-22)32-26-11-3-1-9-24(26)25-10-2-4-12-27(25)32/h1-4,9-16,21H,5-8,18-19H2/q+1 |
| InChIKey | KBDWSDUCJDQJEO-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|